C25H39N4O9PS — CID 58661615
tert-butyl 2-[[(2S)-6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-1-oxo-1-thiophosphorosohexan-2-yl]amino]acetate (PubChem CID 58661615) has the molecular formula C25H39N4O9PS and a molecular weight of 602.65 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-1-oxo-1-thiophosphorosohexan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-1-oxo-1-thiophosphorosohexan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 58661615 |
| Molecular Formula | C25H39N4O9PS |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | tert-butyl 2-[[(2S)-6-[[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]acetyl]amino]-1-oxo-1-thiophosphorosohexan-2-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN[C@@H](CCCCNC(=O)COCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)P=S |
| InChI | InChI=1S/C25H39N4O9PS/c1-25(2,3)38-23(34)16-28-18(24(35)39-40)6-4-5-10-26-20(31)17-37-15-14-36-13-11-27-19(30)9-12-29-21(32)7-8-22(29)33/h7-8,18,28H,4-6,9-17H2,1-3H3,(H,26,31)(H,27,30)/t18-/m0/s1 |
| InChIKey | ISLLRXDOYYTJJN-SFHVURJKSA-N |
| XLogP | -0.03 |
| TPSA | 169.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|