C39H76O3Si3 — CID 58661781
[5-[(3R,5R,9Z)-9-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]spiro[4.5]decan-3-yl]-2-methylpentan-2-yl]oxy-trimethylsilane (PubChem CID 58661781) has the molecular formula C39H76O3Si3 and a molecular weight of 677.29 g/mol. Its IUPAC name is [5-[(3R,5R,9Z)-9-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]spiro[4.5]decan-3-yl]-2-methylpentan-2-yl]oxy-trimethylsilane.
| Compound Name | [5-[(3R,5R,9Z)-9-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]spiro[4.5]decan-3-yl]-2-methylpentan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 58661781 |
| Molecular Formula | C39H76O3Si3 |
| Molecular Weight | 677.29 g/mol |
| Exact Mass | 676.51 |
| IUPAC Name | [5-[(3R,5R,9Z)-9-[2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]cyclohexylidene]ethylidene]spiro[4.5]decan-3-yl]-2-methylpentan-2-yl]oxy-trimethylsilane |
| SMILES | CC(C)(CCC[C@@H]1CC[C@]2(CCC/C(=C/C=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)C3)C2)C1)O[Si](C)(C)C |
| InChI | InChI=1S/C39H76O3Si3/c1-36(2,3)44(12,13)40-34-26-33(27-35(28-34)41-45(14,15)37(4,5)6)21-20-31-19-17-24-39(29-31)25-22-32(30-39)18-16-23-38(7,8)42-43(9,10)11/h20-21,32,34-35H,16-19,22-30H2,1-15H3/b31-20-/t32-,34-,35-,39+/m1/s1 |
| InChIKey | PESXWSICUGXVSI-GMQJAMJGSA-N |
| XLogP | 12.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.29 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|