About 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide
2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide (PubChem CID 58661929) has the molecular formula C9H7N5OS
and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide.
Molecular Properties
| Compound Name | 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide |
| PubChem CID | 58661929 |
| Molecular Formula | C9H7N5OS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide |
| SMILES | NC(=O)c1n[nH]c2ccc3nc(N)sc3c12 |
| InChI | InChI=1S/C9H7N5OS/c10-8(15)6-5-3(13-14-6)1-2-4-7(5)16-9(11)12-4/h1-2H,(H2,10,15)(H2,11,12)(H,13,14) |
| InChIKey | SZJILMNCMWXUBA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide?
The IUPAC name of 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide (CID 58661929) is 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide.
What is the SMILES notation for 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide?
The canonical SMILES for 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide is NC(=O)c1n[nH]c2ccc3nc(N)sc3c12.
What is the InChIKey of 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide?
The InChIKey is SZJILMNCMWXUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5OS/c10-8(15)6-5-3(13-14-6)1-2-4-7(5)16-9(11)12-4/h1-2H,(H2,10,15)(H2,11,12)(H,13,14).
What are the key properties of 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide?
2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide has a molecular weight of 233.26 g/mol, XLogP of 0.85, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6H-pyrazolo[3,4-g][1,3]benzothiazole-8-carboxamide is sourced from PubChem (CID 58661929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).