About CID 58662835
CID 58662835 (PubChem CID 58662835) has the molecular formula C20H20Cl2NO5
and a molecular weight of 425.29 g/mol.
Molecular Properties
| Compound Name | CID 58662835 |
| PubChem CID | 58662835 |
| Molecular Formula | C20H20Cl2NO5 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | — |
| SMILES | Cc1cc(Oc2c(Cl)cc(C(=O)N[CH]C(=O)O)c(C)c2Cl)cc(C(C)C)c1O |
| InChI | InChI=1S/C20H20Cl2NO5/c1-9(2)13-6-12(5-10(3)18(13)26)28-19-15(21)7-14(11(4)17(19)22)20(27)23-8-16(24)25/h5-9,26H,1-4H3,(H,23,27)(H,24,25) |
| InChIKey | VCAJUPYAEPHLNV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 58662835 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58662835?
The IUPAC name of CID 58662835 (CID 58662835) is not available.
What is the SMILES notation for CID 58662835?
The canonical SMILES for CID 58662835 is Cc1cc(Oc2c(Cl)cc(C(=O)N[CH]C(=O)O)c(C)c2Cl)cc(C(C)C)c1O.
What is the InChIKey of CID 58662835?
The InChIKey is VCAJUPYAEPHLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2NO5/c1-9(2)13-6-12(5-10(3)18(13)26)28-19-15(21)7-14(11(4)17(19)22)20(27)23-8-16(24)25/h5-9,26H,1-4H3,(H,23,27)(H,24,25).
What are the key properties of CID 58662835?
CID 58662835 has a molecular weight of 425.29 g/mol, XLogP of 5.21, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58662835 is sourced from PubChem (CID 58662835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).