C13H10F12O2 — CID 58662958
(1S,6S)-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-bis(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane (PubChem CID 58662958) has the molecular formula C13H10F12O2 and a molecular weight of 426.20 g/mol. Its IUPAC name is (1S,6S)-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-bis(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane.
| Compound Name | (1S,6S)-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-bis(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane |
|---|---|
| PubChem CID | 58662958 |
| Molecular Formula | C13H10F12O2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (1S,6S)-8-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4,4-bis(trifluoromethyl)-3-oxatricyclo[4.2.1.02,5]nonane |
| SMILES | FC(F)(F)C(OC1C[C@@H]2C[C@@H]1C1OC(C(F)(F)F)(C(F)(F)F)C12)C(F)(F)F |
| InChI | InChI=1S/C13H10F12O2/c14-10(15,16)8(11(17,18)19)26-5-2-3-1-4(5)7-6(3)9(27-7,12(20,21)22)13(23,24)25/h3-8H,1-2H2/t3-,4-,5?,6?,7?/m0/s1 |
| InChIKey | ZYPJXPPXFQLGDI-PWSZLAETSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |