C39H33N5 — CID 58663487
9-phenyl-3-[6-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)-2-pyridinyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole (PubChem CID 58663487) has the molecular formula C39H33N5 and a molecular weight of 571.73 g/mol. Its IUPAC name is 9-phenyl-3-[6-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)-2-pyridinyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole.
| Compound Name | 9-phenyl-3-[6-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)-2-pyridinyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole |
|---|---|
| PubChem CID | 58663487 |
| Molecular Formula | C39H33N5 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | 9-phenyl-3-[6-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)-2-pyridinyl]-5,6,7,8-tetrahydropyrido[2,3-b]indole |
| SMILES | c1ccc(-n2c3c(c4cc(-c5cccc(-c6cnc7c(c6)c6c(n7-c7ccccc7)CCCC6)n5)cnc42)CCCC3)cc1 |
| InChI | InChI=1S/C39H33N5/c1-3-12-28(13-4-1)43-36-20-9-7-16-30(36)32-22-26(24-40-38(32)43)34-18-11-19-35(42-34)27-23-33-31-17-8-10-21-37(31)44(39(33)41-25-27)29-14-5-2-6-15-29/h1-6,11-15,18-19,22-25H,7-10,16-17,20-21H2 |
| InChIKey | GLOLKDBBWIWOIJ-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |