C56H44N6 — CID 58663531
3-[3-(2,6-diphenylpyrimidin-4-yl)-5-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)phenyl]-9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole (PubChem CID 58663531) has the molecular formula C56H44N6 and a molecular weight of 801.01 g/mol. Its IUPAC name is 3-[3-(2,6-diphenylpyrimidin-4-yl)-5-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)phenyl]-9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole.
| Compound Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)-5-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)phenyl]-9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole |
|---|---|
| PubChem CID | 58663531 |
| Molecular Formula | C56H44N6 |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 800.36 |
| IUPAC Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)-5-(9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-3-yl)phenyl]-9-phenyl-5,6,7,8-tetrahydropyrido[2,3-b]indole |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cnc5c(c4)c4c(n5-c5ccccc5)CCCC4)cc(-c4cnc5c(c4)c4c(n5-c5ccccc5)CCCC4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C56H44N6/c1-5-17-37(18-6-1)50-34-51(60-54(59-50)38-19-7-2-8-20-38)41-30-39(42-32-48-46-25-13-15-27-52(46)61(55(48)57-35-42)44-21-9-3-10-22-44)29-40(31-41)43-33-49-47-26-14-16-28-53(47)62(56(49)58-36-43)45-23-11-4-12-24-45/h1-12,17-24,29-36H,13-16,25-28H2 |
| InChIKey | PDEKCOOTWVWACZ-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |