C57H60N6 — CID 58663535
9-[3,5-bis[4-(1,2-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-9-yl)phenyl]phenyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole (PubChem CID 58663535) has the molecular formula C57H60N6 and a molecular weight of 829.15 g/mol. Its IUPAC name is 9-[3,5-bis[4-(1,2-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-9-yl)phenyl]phenyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole.
| Compound Name | 9-[3,5-bis[4-(1,2-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-9-yl)phenyl]phenyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58663535 |
| Molecular Formula | C57H60N6 |
| Molecular Weight | 829.15 g/mol |
| Exact Mass | 828.49 |
| IUPAC Name | 9-[3,5-bis[4-(1,2-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-9-yl)phenyl]phenyl]-1,2-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indole |
| SMILES | CC1c2c(c3ccccc3n2-c2cc(-c3ccc(N4c5ccccc5C5CCN(C)C(C)C54)cc3)cc(-c3ccc(N4c5ccccc5C5CCN(C)C(C)C54)cc3)c2)CCN1C |
| InChI | InChI=1S/C57H60N6/c1-36-55-49(27-30-58(36)4)46-13-7-10-16-52(46)61(55)43-23-19-39(20-24-43)41-33-42(35-45(34-41)63-54-18-12-9-15-48(54)51-29-32-60(6)38(3)57(51)63)40-21-25-44(26-22-40)62-53-17-11-8-14-47(53)50-28-31-59(5)37(2)56(50)62/h7-26,33-38,49-50,55-56H,27-32H2,1-6H3 |
| InChIKey | IEDHFTQQTFEMMR-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 21.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.15 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |