C13H18BNO3 — CID 58663844
4,6-dimethyl-2,13,14-trioxa-10-aza-1-boratricyclo[8.3.3.03,8]hexadeca-3,5,7-triene (PubChem CID 58663844) has the molecular formula C13H18BNO3 and a molecular weight of 247.10 g/mol. Its IUPAC name is 4,6-dimethyl-2,13,14-trioxa-10-aza-1-boratricyclo[8.3.3.03,8]hexadeca-3,5,7-triene.
| Compound Name | 4,6-dimethyl-2,13,14-trioxa-10-aza-1-boratricyclo[8.3.3.03,8]hexadeca-3,5,7-triene |
|---|---|
| PubChem CID | 58663844 |
| Molecular Formula | C13H18BNO3 |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4,6-dimethyl-2,13,14-trioxa-10-aza-1-boratricyclo[8.3.3.03,8]hexadeca-3,5,7-triene |
| SMILES | Cc1cc(C)c2c(c1)CN1CCOB(OCC1)O2 |
| InChI | InChI=1S/C13H18BNO3/c1-10-7-11(2)13-12(8-10)9-15-3-5-16-14(18-13)17-6-4-15/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | MDFFPOWBSCJZNN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|