C14H28O — CID 58663904
5-butoxy-1,1,3,3-tetramethylcyclohexane (PubChem CID 58663904) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is 5-butoxy-1,1,3,3-tetramethylcyclohexane.
| Compound Name | 5-butoxy-1,1,3,3-tetramethylcyclohexane |
|---|---|
| PubChem CID | 58663904 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 5-butoxy-1,1,3,3-tetramethylcyclohexane |
| SMILES | CCCCOC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28O/c1-6-7-8-15-12-9-13(2,3)11-14(4,5)10-12/h12H,6-11H2,1-5H3 |
| InChIKey | NIXPUGVJPGZLJP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|