C24H26N4O5 — CID 58664115
methyl 3-(4-hydroxyphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]butanoate (PubChem CID 58664115) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is methyl 3-(4-hydroxyphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]butanoate.
| Compound Name | methyl 3-(4-hydroxyphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]butanoate |
|---|---|
| PubChem CID | 58664115 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | methyl 3-(4-hydroxyphenyl)-2-[3-(9-oxo-1,3,10-triazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-2-yl)propanoylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)CCc1nc2cccc3c2n1CCNC3=O)C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H26N4O5/c1-14(15-6-8-16(29)9-7-15)21(24(32)33-2)27-20(30)11-10-19-26-18-5-3-4-17-22(18)28(19)13-12-25-23(17)31/h3-9,14,21,29H,10-13H2,1-2H3,(H,25,31)(H,27,30) |
| InChIKey | UWOUDAULWIJHIT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |