C16H27N3 — CID 58664992
(2E,6E,10E)-1-azido-2,6,10-trimethyltrideca-2,6,10-triene (PubChem CID 58664992) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (2E,6E,10E)-1-azido-2,6,10-trimethyltrideca-2,6,10-triene.
| Compound Name | (2E,6E,10E)-1-azido-2,6,10-trimethyltrideca-2,6,10-triene |
|---|---|
| PubChem CID | 58664992 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (2E,6E,10E)-1-azido-2,6,10-trimethyltrideca-2,6,10-triene |
| SMILES | CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CN=[N+]=[N-] |
| InChI | InChI=1S/C16H27N3/c1-5-8-14(2)9-6-10-15(3)11-7-12-16(4)13-18-19-17/h8,10,12H,5-7,9,11,13H2,1-4H3/b14-8+,15-10+,16-12+ |
| InChIKey | ZONONLXCXQGXCK-KXKGTINYSA-N |
| XLogP | 6.11 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|