C29H35FN4O4S — CID 58665111
(2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide (PubChem CID 58665111) has the molecular formula C29H35FN4O4S and a molecular weight of 554.69 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide.
| Compound Name | (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide |
|---|---|
| PubChem CID | 58665111 |
| Molecular Formula | C29H35FN4O4S |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (2S)-2-amino-6-[(2-fluorophenyl)sulfonylamino]-N-[(1S,2R)-6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide |
| SMILES | COc1ccc2c(c1)CC[C@@H](NC(=O)[C@@H](N)CCCCNS(=O)(=O)c1ccccc1F)[C@H]2Cc1cccnc1 |
| InChI | InChI=1S/C29H35FN4O4S/c1-38-22-12-13-23-21(18-22)11-14-27(24(23)17-20-7-6-15-32-19-20)34-29(35)26(31)9-4-5-16-33-39(36,37)28-10-3-2-8-25(28)30/h2-3,6-8,10,12-13,15,18-19,24,26-27,33H,4-5,9,11,14,16-17,31H2,1H3,(H,34,35)/t24-,26-,27+/m0/s1 |
| InChIKey | KESVXMZYIKLTCT-DOEKTCAHSA-N |
| XLogP | 3.46 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|