About 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+)
1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) (PubChem CID 58665646) has the molecular formula C14H23Zr
and a molecular weight of 282.56 g/mol. Its IUPAC name is 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+).
Molecular Properties
| Compound Name | 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) |
| PubChem CID | 58665646 |
| Molecular Formula | C14H23Zr |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) |
| SMILES | [CH2-]Cc1ccc(C(C)CC)cc1.[CH3-].[CH3-].[Zr+3] |
| InChI | InChI=1S/C12H17.2CH3.Zr/c1-4-10(3)12-8-6-11(5-2)7-9-12;;;/h6-10H,2,4-5H2,1,3H3;2*1H3;/q3*-1;+3 |
| InChIKey | HLTJAINYSKUDLW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+)?
The IUPAC name of 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) (CID 58665646) is 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+).
What is the SMILES notation for 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+)?
The canonical SMILES for 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) is [CH2-]Cc1ccc(C(C)CC)cc1.[CH3-].[CH3-].[Zr+3].
What is the InChIKey of 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+)?
The InChIKey is HLTJAINYSKUDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17.2CH3.Zr/c1-4-10(3)12-8-6-11(5-2)7-9-12;;;/h6-10H,2,4-5H2,1,3H3;2*1H3;/q3*-1;+3.
What are the key properties of 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+)?
1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) has a molecular weight of 282.56 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-4-ethylbenzene;carbanide;zirconium(3+) is sourced from PubChem (CID 58665646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).