C40H33F3N6OS — CID 58665967
(2S)-1-[[5-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 58665967) has the molecular formula C40H33F3N6OS and a molecular weight of 702.81 g/mol. Its IUPAC name is (2S)-1-[[5-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[[5-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 58665967 |
| Molecular Formula | C40H33F3N6OS |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | (2S)-1-[[5-[6-[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]imidazo[1,2-a]pyridin-3-yl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCN1Cc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4C(F)(F)F)cn23)s1 |
| InChI | InChI=1S/C40H33F3N6OS/c41-40(42,43)37-32(26-49(46-37)39(28-11-4-1-5-12-28,29-13-6-2-7-14-29)30-15-8-3-9-16-30)27-18-21-36-45-23-34(48(36)24-27)35-20-19-31(51-35)25-47-22-10-17-33(47)38(44)50/h1-9,11-16,18-21,23-24,26,33H,10,17,22,25H2,(H2,44,50)/t33-/m0/s1 |
| InChIKey | IIRLEGLBDLQRBX-XIFFEERXSA-N |
| XLogP | 8.23 |
| TPSA | 81.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|