C30H40F5NO2S — CID 58666028
3-[(3S,4S)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]pyridine (PubChem CID 58666028) has the molecular formula C30H40F5NO2S and a molecular weight of 573.71 g/mol. Its IUPAC name is 3-[(3S,4S)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]pyridine.
| Compound Name | 3-[(3S,4S)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]pyridine |
|---|---|
| PubChem CID | 58666028 |
| Molecular Formula | C30H40F5NO2S |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 3-[(3S,4S)-7-methoxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]pyridine |
| SMILES | COc1ccc2c(c1)OC[C@](C)(c1cccnc1)[C@@H]2CCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H40F5NO2S/c1-28(23-12-10-17-36-21-23)22-38-27-20-24(37-2)14-15-25(27)26(28)13-8-6-4-3-5-7-9-18-39-19-11-16-29(31,32)30(33,34)35/h10,12,14-15,17,20-21,26H,3-9,11,13,16,18-19,22H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | BUAVPLAXBDXPDZ-IXCJQBJRSA-N |
| XLogP | 9.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|