C32H41F5O4S — CID 58666045
methyl 4-[(3S,4S)-7-hydroxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate (PubChem CID 58666045) has the molecular formula C32H41F5O4S and a molecular weight of 616.73 g/mol. Its IUPAC name is methyl 4-[(3S,4S)-7-hydroxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate.
| Compound Name | methyl 4-[(3S,4S)-7-hydroxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate |
|---|---|
| PubChem CID | 58666045 |
| Molecular Formula | C32H41F5O4S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.26 |
| IUPAC Name | methyl 4-[(3S,4S)-7-hydroxy-3-methyl-4-[9-(4,4,5,5,5-pentafluoropentylsulfanyl)nonyl]-2,4-dihydrochromen-3-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@]2(C)COc3cc(O)ccc3[C@H]2CCCCCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H41F5O4S/c1-30(24-14-12-23(13-15-24)29(39)40-2)22-41-28-21-25(38)16-17-26(28)27(30)11-8-6-4-3-5-7-9-19-42-20-10-18-31(33,34)32(35,36)37/h12-17,21,27,38H,3-11,18-20,22H2,1-2H3/t27-,30-/m1/s1 |
| InChIKey | FNNWTQUWTLCROJ-POURPWNDSA-N |
| XLogP | 9.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|