C46H80O2Si3 — CID 58666132
bis[4-[hex-5-enyl-di(propan-2-yl)silyl]oxy-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 58666132) has the molecular formula C46H80O2Si3 and a molecular weight of 749.40 g/mol. Its IUPAC name is bis[4-[hex-5-enyl-di(propan-2-yl)silyl]oxy-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[4-[hex-5-enyl-di(propan-2-yl)silyl]oxy-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 58666132 |
| Molecular Formula | C46H80O2Si3 |
| Molecular Weight | 749.40 g/mol |
| Exact Mass | 748.55 |
| IUPAC Name | bis[4-[hex-5-enyl-di(propan-2-yl)silyl]oxy-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | C=CCCCC[Si](OC1=CC=CC2C1CC(C)C2[Si](C)(C)C1C(C)CC2C(O[Si](CCCCC=C)(C(C)C)C(C)C)=CC=CC21)(C(C)C)C(C)C |
| InChI | InChI=1S/C46H80O2Si3/c1-15-17-19-21-29-50(33(3)4,34(5)6)47-43-27-23-25-39-41(43)31-37(11)45(39)49(13,14)46-38(12)32-42-40(46)26-24-28-44(42)48-51(35(7)8,36(9)10)30-22-20-18-16-2/h15-16,23-28,33-42,45-46H,1-2,17-22,29-32H2,3-14H3 |
| InChIKey | DXBQOBFSLAJHAY-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.40 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|