C27H54O2Si2 — CID 58666152
tri(propan-2-yl)-[[1-tri(propan-2-yl)silyloxy-3a,4,5,6,7,7a-hexahydro-3H-inden-4-yl]oxy]silane (PubChem CID 58666152) has the molecular formula C27H54O2Si2 and a molecular weight of 466.90 g/mol. Its IUPAC name is tri(propan-2-yl)-[[1-tri(propan-2-yl)silyloxy-3a,4,5,6,7,7a-hexahydro-3H-inden-4-yl]oxy]silane.
| Compound Name | tri(propan-2-yl)-[[1-tri(propan-2-yl)silyloxy-3a,4,5,6,7,7a-hexahydro-3H-inden-4-yl]oxy]silane |
|---|---|
| PubChem CID | 58666152 |
| Molecular Formula | C27H54O2Si2 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | tri(propan-2-yl)-[[1-tri(propan-2-yl)silyloxy-3a,4,5,6,7,7a-hexahydro-3H-inden-4-yl]oxy]silane |
| SMILES | CC(C)[Si](OC1=CCC2C(O[Si](C(C)C)(C(C)C)C(C)C)CCCC12)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H54O2Si2/c1-18(2)30(19(3)4,20(5)6)28-26-15-13-14-24-25(26)16-17-27(24)29-31(21(7)8,22(9)10)23(11)12/h17-26H,13-16H2,1-12H3 |
| InChIKey | DQFDGHPKCALTLP-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|