About (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten
(2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten (PubChem CID 58666226) has the molecular formula C15H27OW-
and a molecular weight of 407.22 g/mol. Its IUPAC name is (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten.
Molecular Properties
| Compound Name | (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten |
| PubChem CID | 58666226 |
| Molecular Formula | C15H27OW- |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten |
| SMILES | C/C=C/C=C\C(OCCC(C)[CH-]C)C(C)C.[W] |
| InChI | InChI=1S/C15H27O.W/c1-6-8-9-10-15(13(3)4)16-12-11-14(5)7-2;/h6-10,13-15H,11-12H2,1-5H3;/q-1;/b8-6+,10-9-; |
| InChIKey | DJTVCISSKQCBGR-PZFMUWDSSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten?
The IUPAC name of (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten (CID 58666226) is (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten.
What is the SMILES notation for (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten?
The canonical SMILES for (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten is C/C=C/C=C\C(OCCC(C)[CH-]C)C(C)C.[W].
What is the InChIKey of (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten?
The InChIKey is DJTVCISSKQCBGR-PZFMUWDSSA-N. The full InChI is InChI=1S/C15H27O.W/c1-6-8-9-10-15(13(3)4)16-12-11-14(5)7-2;/h6-10,13-15H,11-12H2,1-5H3;/q-1;/b8-6+,10-9-;.
What are the key properties of (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten?
(2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten has a molecular weight of 407.22 g/mol, XLogP of 4.41, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-7-methyl-6-(3-methylpentoxy)octa-2,4-diene;tungsten is sourced from PubChem (CID 58666226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).