C15H30N2O — CID 58666496
(2S)-2-amino-N-[(3S)-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide (PubChem CID 58666496) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 58666496 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-2,5-dimethylhex-4-en-3-yl]-N,3,3-trimethylbutanamide |
| SMILES | CC(C)=C[C@H](C(C)C)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H30N2O/c1-10(2)9-12(11(3)4)17(8)14(18)13(16)15(5,6)7/h9,11-13H,16H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | GFKQJJWLLVGESV-CHWSQXEVSA-N |
| XLogP | 2.81 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|