About 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium
4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium (PubChem CID 58666523) has the molecular formula C10H10N3Y-
and a molecular weight of 261.12 g/mol. Its IUPAC name is 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium.
Molecular Properties
| Compound Name | 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium |
| PubChem CID | 58666523 |
| Molecular Formula | C10H10N3Y- |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium |
| SMILES | C=C1C=CN(C)c2n[c-]nc(C)c21.[Y] |
| InChI | InChI=1S/C10H10N3.Y/c1-7-4-5-13(3)10-9(7)8(2)11-6-12-10;/h4-5H,1H2,2-3H3;/q-1; |
| InChIKey | DQKRBRNPTTXCIX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium?
The IUPAC name of 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium (CID 58666523) is 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium.
What is the SMILES notation for 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium?
The canonical SMILES for 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium is C=C1C=CN(C)c2n[c-]nc(C)c21.[Y].
What is the InChIKey of 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium?
The InChIKey is DQKRBRNPTTXCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N3.Y/c1-7-4-5-13(3)10-9(7)8(2)11-6-12-10;/h4-5H,1H2,2-3H3;/q-1;.
What are the key properties of 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium?
4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium has a molecular weight of 261.12 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethyl-5-methylidene-2H-pyrido[2,3-d]pyrimidin-2-ide;yttrium is sourced from PubChem (CID 58666523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).