C6H12Ac4O5 — CID 58666535
actinium;(2R,4R,5S)-5-[(1S)-1-hydroxyethyl]oxolane-2,3,4-triol (PubChem CID 58666535) has the molecular formula C6H12Ac4O5 and a molecular weight of 1072.16 g/mol. Its IUPAC name is actinium;(2R,4R,5S)-5-[(1S)-1-hydroxyethyl]oxolane-2,3,4-triol.
| Compound Name | actinium;(2R,4R,5S)-5-[(1S)-1-hydroxyethyl]oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 58666535 |
| Molecular Formula | C6H12Ac4O5 |
| Molecular Weight | 1072.16 g/mol |
| Exact Mass | 1072.18 |
| IUPAC Name | actinium;(2R,4R,5S)-5-[(1S)-1-hydroxyethyl]oxolane-2,3,4-triol |
| SMILES | C[C@H](O)[C@@H]1O[C@@H](O)C(O)[C@H]1O.[Ac].[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C6H12O5.4Ac/c1-2(7)5-3(8)4(9)6(10)11-5;;;;/h2-10H,1H3;;;;/t2-,3+,4?,5-,6+;;;;/m0..../s1 |
| InChIKey | NBXMTCLASSSSMA-XUDACFIWSA-N |
| XLogP | -2.19 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1072.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |