About CID 58667028
CID 58667028 (PubChem CID 58667028) has the molecular formula C9H15BN2O2
and a molecular weight of 194.04 g/mol.
Molecular Properties
| Compound Name | CID 58667028 |
| PubChem CID | 58667028 |
| Molecular Formula | C9H15BN2O2 |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCN(C)C[C@@H]1CC(C)=O |
| InChI | InChI=1S/C9H15BN2O2/c1-7(13)5-8-6-11(2)3-4-12(8)9(10)14/h8H,3-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | LVVMHVLGHUZNEN-QMMMGPOBSA-N |
| XLogP | -0.13 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58667028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58667028?
The IUPAC name of CID 58667028 (CID 58667028) is not available.
What is the SMILES notation for CID 58667028?
The canonical SMILES for CID 58667028 is [B]C(=O)N1CCN(C)C[C@@H]1CC(C)=O.
What is the InChIKey of CID 58667028?
The InChIKey is LVVMHVLGHUZNEN-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H15BN2O2/c1-7(13)5-8-6-11(2)3-4-12(8)9(10)14/h8H,3-6H2,1-2H3/t8-/m0/s1.
What are the key properties of CID 58667028?
CID 58667028 has a molecular weight of 194.04 g/mol, XLogP of -0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58667028 is sourced from PubChem (CID 58667028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).