C28H36FN3O2 — CID 58667050
1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-8-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 58667050) has the molecular formula C28H36FN3O2 and a molecular weight of 465.61 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-8-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-8-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 58667050 |
| Molecular Formula | C28H36FN3O2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[(2R)-oxiran-2-yl]methyl]-8-[(2,3,4,5,6-pentamethylphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | Cc1c(C)c(C)c(CN2CCC3(CC2)C(=O)N(C[C@@H]2CO2)CN3c2ccc(F)cc2)c(C)c1C |
| InChI | InChI=1S/C28H36FN3O2/c1-18-19(2)21(4)26(22(5)20(18)3)15-30-12-10-28(11-13-30)27(33)31(14-25-16-34-25)17-32(28)24-8-6-23(29)7-9-24/h6-9,25H,10-17H2,1-5H3/t25-/m1/s1 |
| InChIKey | FNZYDLZGXJPPFZ-RUZDIDTESA-N |
| XLogP | 4.41 |
| TPSA | 39.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|