C26H20N2O6S2 — CID 58667396
4-[2,9-dimethyl-7-(4-sulfinooxyphenyl)-1,10-phenanthrolin-4-yl]benzenesulfonic acid (PubChem CID 58667396) has the molecular formula C26H20N2O6S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-[2,9-dimethyl-7-(4-sulfinooxyphenyl)-1,10-phenanthrolin-4-yl]benzenesulfonic acid.
| Compound Name | 4-[2,9-dimethyl-7-(4-sulfinooxyphenyl)-1,10-phenanthrolin-4-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58667396 |
| Molecular Formula | C26H20N2O6S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 4-[2,9-dimethyl-7-(4-sulfinooxyphenyl)-1,10-phenanthrolin-4-yl]benzenesulfonic acid |
| SMILES | Cc1cc(-c2ccc(OS(=O)O)cc2)c2ccc3c(-c4ccc(S(=O)(=O)O)cc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C26H20N2O6S2/c1-15-13-23(17-3-7-19(8-4-17)34-35(29)30)21-11-12-22-24(14-16(2)28-26(22)25(21)27-15)18-5-9-20(10-6-18)36(31,32)33/h3-14H,1-2H3,(H,29,30)(H,31,32,33) |
| InChIKey | YSUJZFAGWGUUTJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|