C21H19EuF3N2O2S — CID 58667422
europium;5-methyl-1,10-phenanthroline;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol (PubChem CID 58667422) has the molecular formula C21H19EuF3N2O2S and a molecular weight of 572.42 g/mol. Its IUPAC name is europium;5-methyl-1,10-phenanthroline;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol.
| Compound Name | europium;5-methyl-1,10-phenanthroline;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 58667422 |
| Molecular Formula | C21H19EuF3N2O2S |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | europium;5-methyl-1,10-phenanthroline;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
| SMILES | Cc1cc2cccnc2c2ncccc12.OC(CC(O)C(F)(F)F)c1cccs1.[Eu] |
| InChI | InChI=1S/C13H10N2.C8H9F3O2S.Eu/c1-9-8-10-4-2-6-14-12(10)13-11(9)5-3-7-15-13;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h2-8H,1H3;1-3,5,7,12-13H,4H2; |
| InChIKey | MMTNSCMMRUMILB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|