C38H30EuF3N2O8P2+ — CID 58667430
europium;hydroxy-oxo-[4-[7-(4-phosphonophenyl)-1,10-phenanthrolin-4-yl]phenoxy]phosphanium;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol (PubChem CID 58667430) has the molecular formula C38H30EuF3N2O8P2+ and a molecular weight of 913.57 g/mol. Its IUPAC name is europium;hydroxy-oxo-[4-[7-(4-phosphonophenyl)-1,10-phenanthrolin-4-yl]phenoxy]phosphanium;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol.
| Compound Name | europium;hydroxy-oxo-[4-[7-(4-phosphonophenyl)-1,10-phenanthrolin-4-yl]phenoxy]phosphanium;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 58667430 |
| Molecular Formula | C38H30EuF3N2O8P2+ |
| Molecular Weight | 913.57 g/mol |
| Exact Mass | 914.06 |
| IUPAC Name | europium;hydroxy-oxo-[4-[7-(4-phosphonophenyl)-1,10-phenanthrolin-4-yl]phenoxy]phosphanium;4,4,4-trifluoro-1-naphthalen-2-ylbutane-1,3-diol |
| SMILES | O=[P+](O)Oc1ccc(-c2ccnc3c2ccc2c(-c4ccc(P(=O)(O)O)cc4)ccnc23)cc1.OC(CC(O)C(F)(F)F)c1ccc2ccccc2c1.[Eu] |
| InChI | InChI=1S/C24H16N2O6P2.C14H13F3O2.Eu/c27-33(28)32-17-5-1-15(2-6-17)19-11-13-25-23-21(19)9-10-22-20(12-14-26-24(22)23)16-3-7-18(8-4-16)34(29,30)31;15-14(16,17)13(19)8-12(18)11-6-5-9-3-1-2-4-10(9)7-11;/h1-14H,(H2-,27,28,29,30,31);1-7,12-13,18-19H,8H2;/p+1 |
| InChIKey | JHBPLGLGMBTTAW-UHFFFAOYSA-O |
| XLogP | 8.14 |
| TPSA | 170.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.57 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|