C16H27NO5 — CID 58667928
1-O-tert-butyl 2-O-methyl (2S)-5-(3-hydroxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 58667928) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-5-(3-hydroxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-hydroxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58667928 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-hydroxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C(CCCO)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO5/c1-16(2,3)22-15(20)17-10-9-12(6-5-11-18)7-8-13(17)14(19)21-4/h7,13,18H,5-6,8-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | DGECPSLVLSUEIG-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|