C17H29NO5 — CID 58667935
1-O-tert-butyl 2-O-methyl (2S)-5-(3-methoxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate (PubChem CID 58667935) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S)-5-(3-methoxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-methoxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58667935 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S)-5-(3-methoxypropyl)-2,3,6,7-tetrahydroazepine-1,2-dicarboxylate |
| SMILES | COCCCC1=CC[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H29NO5/c1-17(2,3)23-16(20)18-11-10-13(7-6-12-21-4)8-9-14(18)15(19)22-5/h8,14H,6-7,9-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | ZBMINUICPJIFKZ-AWEZNQCLSA-N |
| XLogP | 2.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|