C25H40ClN3O6S — CID 58667983
(2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(4-pyridin-3-yloxybutyl)azepane-2-carboxamide (PubChem CID 58667983) has the molecular formula C25H40ClN3O6S and a molecular weight of 546.13 g/mol. Its IUPAC name is (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(4-pyridin-3-yloxybutyl)azepane-2-carboxamide.
| Compound Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(4-pyridin-3-yloxybutyl)azepane-2-carboxamide |
|---|---|
| PubChem CID | 58667983 |
| Molecular Formula | C25H40ClN3O6S |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | (2S,5S)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-5-(4-pyridin-3-yloxybutyl)azepane-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2CC[C@H](CCCCOc3cccnc3)CCN2)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H40ClN3O6S/c1-15(26)19(23-21(31)20(30)22(32)25(35-23)36-2)29-24(33)18-9-8-16(10-12-28-18)6-3-4-13-34-17-7-5-11-27-14-17/h5,7,11,14-16,18-23,25,28,30-32H,3-4,6,8-10,12-13H2,1-2H3,(H,29,33)/t15-,16-,18-,19+,20-,21+,22+,23+,25+/m0/s1 |
| InChIKey | JQNOXTMSUBFQGW-JXBYJHQHSA-N |
| XLogP | 1.67 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|