C20H37FN2O5 — CID 58667987
(2S,5R)-5-(3-fluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide (PubChem CID 58667987) has the molecular formula C20H37FN2O5 and a molecular weight of 404.52 g/mol. Its IUPAC name is (2S,5R)-5-(3-fluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide.
| Compound Name | (2S,5R)-5-(3-fluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 58667987 |
| Molecular Formula | C20H37FN2O5 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (2S,5R)-5-(3-fluoropropyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H]1CC[C@H](CCCF)CCN1)[C@H]1O[C@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H37FN2O5/c1-11(2)15(19-18(26)17(25)16(24)12(3)28-19)23-20(27)14-7-6-13(5-4-9-21)8-10-22-14/h11-19,22,24-26H,4-10H2,1-3H3,(H,23,27)/t12-,13+,14+,15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | UJIQZYRVRDGFFF-FHOPWKSGSA-N |
| XLogP | 0.51 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |