C21H39FN2O5 — CID 58667992
(2S,5S)-5-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide (PubChem CID 58667992) has the molecular formula C21H39FN2O5 and a molecular weight of 418.55 g/mol. Its IUPAC name is (2S,5S)-5-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide.
| Compound Name | (2S,5S)-5-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 58667992 |
| Molecular Formula | C21H39FN2O5 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (2S,5S)-5-(4-fluorobutyl)-N-[(1R)-2-methyl-1-[(2R,3R,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl]azepane-2-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H]1CC[C@H](CCCCF)CCN1)[C@H]1O[C@H](C)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H39FN2O5/c1-12(2)16(20-19(27)18(26)17(25)13(3)29-20)24-21(28)15-8-7-14(9-11-23-15)6-4-5-10-22/h12-20,23,25-27H,4-11H2,1-3H3,(H,24,28)/t13-,14+,15+,16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | WLABUXDREUSCBJ-WWWUCTDISA-N |
| XLogP | 0.90 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|