C16H29NO2 — CID 58667999
tert-butyl (2R)-5-butyl-2-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 58667999) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl (2R)-5-butyl-2-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl (2R)-5-butyl-2-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 58667999 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl (2R)-5-butyl-2-methyl-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | CCCCC1=CC[C@@H](C)N(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO2/c1-6-7-8-14-10-9-13(2)17(12-11-14)15(18)19-16(3,4)5/h10,13H,6-9,11-12H2,1-5H3/t13-/m1/s1 |
| InChIKey | YJRIFSFMRANJBH-CYBMUJFWSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|