C11H13ClO4 — CID 58668018
methyl (1S,4R,5R,7S,11S)-5-chloro-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 58668018) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is methyl (1S,4R,5R,7S,11S)-5-chloro-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1S,4R,5R,7S,11S)-5-chloro-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 58668018 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl (1S,4R,5R,7S,11S)-5-chloro-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2OC[C@H]3[C@@H]2[C@@H]1C[C@H]3Cl |
| InChI | InChI=1S/C11H13ClO4/c1-14-10(13)6-3-15-11-9-5(6)2-8(12)7(9)4-16-11/h3,5,7-9,11H,2,4H2,1H3/t5-,7-,8-,9+,11-/m1/s1 |
| InChIKey | BYKOVUHZEHVIIC-CGFAYKLDSA-N |
| XLogP | 1.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|