C17H28O6 — CID 58668137
(4,5-dihydroxy-2,6-dimethyloxan-3-yl) (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate (PubChem CID 58668137) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is (4,5-dihydroxy-2,6-dimethyloxan-3-yl) (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate.
| Compound Name | (4,5-dihydroxy-2,6-dimethyloxan-3-yl) (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 58668137 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (4,5-dihydroxy-2,6-dimethyloxan-3-yl) (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| SMILES | C=CC(C)(O)CC/C=C(\C)C(=O)OC1C(C)OC(C)C(O)C1O |
| InChI | InChI=1S/C17H28O6/c1-6-17(5,21)9-7-8-10(2)16(20)23-15-12(4)22-11(3)13(18)14(15)19/h6,8,11-15,18-19,21H,1,7,9H2,2-5H3/b10-8+ |
| InChIKey | MEZQSBIHWLDJQI-CSKARUKUSA-N |
| XLogP | 1.09 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|