C11H17NO2 — CID 58668344
(5R,6S,7R)-7-hydroxy-5,6,7-trimethyl-1-azaspiro[3.5]non-8-en-2-one (PubChem CID 58668344) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (5R,6S,7R)-7-hydroxy-5,6,7-trimethyl-1-azaspiro[3.5]non-8-en-2-one.
| Compound Name | (5R,6S,7R)-7-hydroxy-5,6,7-trimethyl-1-azaspiro[3.5]non-8-en-2-one |
|---|---|
| PubChem CID | 58668344 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (5R,6S,7R)-7-hydroxy-5,6,7-trimethyl-1-azaspiro[3.5]non-8-en-2-one |
| SMILES | C[C@@H]1[C@H](C)[C@](C)(O)C=CC12CC(=O)N2 |
| InChI | InChI=1S/C11H17NO2/c1-7-8(2)11(6-9(13)12-11)5-4-10(7,3)14/h4-5,7-8,14H,6H2,1-3H3,(H,12,13)/t7-,8+,10+,11?/m0/s1 |
| InChIKey | HRGPTRNOEWRYJA-MTKZOQNTSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|