C25H39NO5Si2 — CID 58668373
(3R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-5-trimethylsilyloxy-2-oxa-7-azadispiro[2.2.36.23]undec-10-en-8-one (PubChem CID 58668373) has the molecular formula C25H39NO5Si2 and a molecular weight of 489.76 g/mol. Its IUPAC name is (3R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-5-trimethylsilyloxy-2-oxa-7-azadispiro[2.2.36.23]undec-10-en-8-one.
| Compound Name | (3R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-5-trimethylsilyloxy-2-oxa-7-azadispiro[2.2.36.23]undec-10-en-8-one |
|---|---|
| PubChem CID | 58668373 |
| Molecular Formula | C25H39NO5Si2 |
| Molecular Weight | 489.76 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (3R,4S,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-7-phenylmethoxy-5-trimethylsilyloxy-2-oxa-7-azadispiro[2.2.36.23]undec-10-en-8-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@]2(C=C[C@@]13CO3)CC(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C25H39NO5Si2/c1-23(2,3)33(7,8)31-22-21(30-32(4,5)6)24(14-15-25(22)18-28-25)16-20(27)26(24)29-17-19-12-10-9-11-13-19/h9-15,21-22H,16-18H2,1-8H3/t21-,22+,24+,25-/m1/s1 |
| InChIKey | PAZKZMMWUTYDPK-BPJRBCGYSA-N |
| XLogP | 5.04 |
| TPSA | 60.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.76 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|