C26H37NO6Si2 — CID 58668377
(4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1'-phenylmethoxy-5-trimethylsilyloxyspiro[4,5-dihydro-1-benzofuran-6,4'-azetidine]-2,2'-dione (PubChem CID 58668377) has the molecular formula C26H37NO6Si2 and a molecular weight of 515.76 g/mol. Its IUPAC name is (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1'-phenylmethoxy-5-trimethylsilyloxyspiro[4,5-dihydro-1-benzofuran-6,4'-azetidine]-2,2'-dione.
| Compound Name | (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1'-phenylmethoxy-5-trimethylsilyloxyspiro[4,5-dihydro-1-benzofuran-6,4'-azetidine]-2,2'-dione |
|---|---|
| PubChem CID | 58668377 |
| Molecular Formula | C26H37NO6Si2 |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | (4R,5S,6R)-4-[tert-butyl(dimethyl)silyl]oxy-1'-phenylmethoxy-5-trimethylsilyloxyspiro[4,5-dihydro-1-benzofuran-6,4'-azetidine]-2,2'-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C2=CC(=O)OC2=C[C@]2(CC(=O)N2OCc2ccccc2)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C26H37NO6Si2/c1-25(2,3)35(7,8)32-23-19-14-22(29)31-20(19)15-26(24(23)33-34(4,5)6)16-21(28)27(26)30-17-18-12-10-9-11-13-18/h9-15,23-24H,16-17H2,1-8H3/t23-,24-,26+/m1/s1 |
| InChIKey | HWSWJVBVDUMPQV-MZKUHISZSA-N |
| XLogP | 5.08 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|