C17H19F6N3O2 — CID 58668744
tert-butyl N-[2-[4-isocyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethyl]carbamate (PubChem CID 58668744) has the molecular formula C17H19F6N3O2 and a molecular weight of 411.35 g/mol. Its IUPAC name is tert-butyl N-[2-[4-isocyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-isocyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 58668744 |
| Molecular Formula | C17H19F6N3O2 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | tert-butyl N-[2-[4-isocyano-N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)anilino]ethyl]carbamate |
| SMILES | [C-]#[N+]c1ccc(N(CCNC(=O)OC(C)(C)C)CC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H19F6N3O2/c1-15(2,3)28-14(27)25-7-8-26(10-16(18,19)20)11-5-6-13(24-4)12(9-11)17(21,22)23/h5-6,9H,7-8,10H2,1-3H3,(H,25,27) |
| InChIKey | MWCAVOROONFIGZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 45.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|