C24H24N2O4 — CID 58668872
1-N,2-N-dimethoxy-1-N,2-N-dimethyl-3,6-diphenylbenzene-1,2-dicarboxamide (PubChem CID 58668872) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-N,2-N-dimethoxy-1-N,2-N-dimethyl-3,6-diphenylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N,2-N-dimethoxy-1-N,2-N-dimethyl-3,6-diphenylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 58668872 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-N,2-N-dimethoxy-1-N,2-N-dimethyl-3,6-diphenylbenzene-1,2-dicarboxamide |
| SMILES | CON(C)C(=O)c1c(-c2ccccc2)ccc(-c2ccccc2)c1C(=O)N(C)OC |
| InChI | InChI=1S/C24H24N2O4/c1-25(29-3)23(27)21-19(17-11-7-5-8-12-17)15-16-20(18-13-9-6-10-14-18)22(21)24(28)26(2)30-4/h5-16H,1-4H3 |
| InChIKey | MENMALBIVNENEY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|