C28H42N2O6Si — CID 58668967
[(4S,6R,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-ditert-butyl-phenylsilane (PubChem CID 58668967) has the molecular formula C28H42N2O6Si and a molecular weight of 530.74 g/mol. Its IUPAC name is [(4S,6R,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-ditert-butyl-phenylsilane.
| Compound Name | [(4S,6R,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-ditert-butyl-phenylsilane |
|---|---|
| PubChem CID | 58668967 |
| Molecular Formula | C28H42N2O6Si |
| Molecular Weight | 530.74 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | [(4S,6R,6aR)-4-(2,4-dimethoxypyrimidin-5-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy-ditert-butyl-phenylsilane |
| SMILES | COc1ncc([C@@H]2O[C@H](CO[Si](c3ccccc3)(C(C)(C)C)C(C)(C)C)[C@H]3OC(C)(C)OC23)c(OC)n1 |
| InChI | InChI=1S/C28H42N2O6Si/c1-26(2,3)37(27(4,5)6,18-14-12-11-13-15-18)33-17-20-22-23(36-28(7,8)35-22)21(34-20)19-16-29-25(32-10)30-24(19)31-9/h11-16,20-23H,17H2,1-10H3/t20-,21+,22-,23?/m1/s1 |
| InChIKey | KDQOEZMQMZAMHS-VNYJYPEVSA-N |
| XLogP | 4.92 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|