C19H27N5O7 — CID 58668974
[(2S,3aR,6S,7R,7aR)-7-azido-2-(2,4-dimethoxypyrimidin-5-yl)-6-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl] 2,2-dimethylpropanoate (PubChem CID 58668974) has the molecular formula C19H27N5O7 and a molecular weight of 437.45 g/mol. Its IUPAC name is [(2S,3aR,6S,7R,7aR)-7-azido-2-(2,4-dimethoxypyrimidin-5-yl)-6-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3aR,6S,7R,7aR)-7-azido-2-(2,4-dimethoxypyrimidin-5-yl)-6-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58668974 |
| Molecular Formula | C19H27N5O7 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [(2S,3aR,6S,7R,7aR)-7-azido-2-(2,4-dimethoxypyrimidin-5-yl)-6-methoxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl] 2,2-dimethylpropanoate |
| SMILES | COc1ncc([C@@H]2O[C@@H]3[C@H](N=[N+]=[N-])[C@H](OC)CO[C@H]3C2OC(=O)C(C)(C)C)c(OC)n1 |
| InChI | InChI=1S/C19H27N5O7/c1-19(2,3)17(25)31-15-12(9-7-21-18(28-6)22-16(9)27-5)30-13-11(23-24-20)10(26-4)8-29-14(13)15/h7,10-15H,8H2,1-6H3/t10-,11-,12+,13-,14-,15?/m1/s1 |
| InChIKey | FQOWIBUEMUBLKK-SPETUVNMSA-N |
| XLogP | 1.98 |
| TPSA | 146.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|