C12H16N4O7 — CID 58668976
[(2S,3aS,6S,7R,7aR)-2-(2,4-dioxo-1H-pyrimidin-5-yl)-3,6-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-7-yl]urea (PubChem CID 58668976) has the molecular formula C12H16N4O7 and a molecular weight of 328.28 g/mol. Its IUPAC name is [(2S,3aS,6S,7R,7aR)-2-(2,4-dioxo-1H-pyrimidin-5-yl)-3,6-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-7-yl]urea.
| Compound Name | [(2S,3aS,6S,7R,7aR)-2-(2,4-dioxo-1H-pyrimidin-5-yl)-3,6-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-7-yl]urea |
|---|---|
| PubChem CID | 58668976 |
| Molecular Formula | C12H16N4O7 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [(2S,3aS,6S,7R,7aR)-2-(2,4-dioxo-1H-pyrimidin-5-yl)-3,6-dihydroxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-7-yl]urea |
| SMILES | NC(=O)N[C@H]1[C@H]2O[C@@H](c3c[nH]c(=O)[nH]c3=O)C(O)[C@@H]2OC[C@H]1O |
| InChI | InChI=1S/C12H16N4O7/c13-11(20)15-5-4(17)2-22-9-6(18)7(23-8(5)9)3-1-14-12(21)16-10(3)19/h1,4-9,17-18H,2H2,(H3,13,15,20)(H2,14,16,19,21)/t4-,5-,6?,7+,8-,9+/m1/s1 |
| InChIKey | FWJRIMYJDLDJDR-HTVFIZGQSA-N |
| XLogP | -3.34 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |