C15H30O3 — CID 58669103
2-(ethoxymethyl)-5-ethyl-2,3,4,5,6-pentamethyloxan-4-ol (PubChem CID 58669103) has the molecular formula C15H30O3 and a molecular weight of 258.40 g/mol. Its IUPAC name is 2-(ethoxymethyl)-5-ethyl-2,3,4,5,6-pentamethyloxan-4-ol.
| Compound Name | 2-(ethoxymethyl)-5-ethyl-2,3,4,5,6-pentamethyloxan-4-ol |
|---|---|
| PubChem CID | 58669103 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 2-(ethoxymethyl)-5-ethyl-2,3,4,5,6-pentamethyloxan-4-ol |
| SMILES | CCOCC1(C)OC(C)C(C)(CC)C(C)(O)C1C |
| InChI | InChI=1S/C15H30O3/c1-8-13(5)12(4)18-14(6,10-17-9-2)11(3)15(13,7)16/h11-12,16H,8-10H2,1-7H3 |
| InChIKey | MLRJEJBIGZJKDE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |