C19H30O2 — CID 58669343
(2S,4aS,4bR)-2-ethenyl-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-2,9-diol (PubChem CID 58669343) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (2S,4aS,4bR)-2-ethenyl-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-2,9-diol.
| Compound Name | (2S,4aS,4bR)-2-ethenyl-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-2,9-diol |
|---|---|
| PubChem CID | 58669343 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2S,4aS,4bR)-2-ethenyl-4b,8,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthrene-2,9-diol |
| SMILES | C=C[C@]1(O)C=C2CC(O)C3C(C)(C)CCC[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C19H30O2/c1-5-19(21)10-7-14-13(12-19)11-15(20)16-17(2,3)8-6-9-18(14,16)4/h5,12,14-16,20-21H,1,6-11H2,2-4H3/t14-,15?,16?,18+,19+/m0/s1 |
| InChIKey | YMFCOOLCXCHSOS-LDYSDITHSA-N |
| XLogP | 3.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|