C14H20O — CID 58669353
2,2,5,6,7-pentamethyl-3,4-dihydrochromene (PubChem CID 58669353) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 2,2,5,6,7-pentamethyl-3,4-dihydrochromene.
| Compound Name | 2,2,5,6,7-pentamethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 58669353 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2,2,5,6,7-pentamethyl-3,4-dihydrochromene |
| SMILES | Cc1cc2c(c(C)c1C)CCC(C)(C)O2 |
| InChI | InChI=1S/C14H20O/c1-9-8-13-12(11(3)10(9)2)6-7-14(4,5)15-13/h8H,6-7H2,1-5H3 |
| InChIKey | NDLRQIFLTWEGQK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |