C28H39N5O2 — CID 58669832
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-amine (PubChem CID 58669832) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-amine.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-amine |
|---|---|
| PubChem CID | 58669832 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(4-ethoxy-2-methoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazin-4-amine |
| SMILES | CCOc1ccc(-n2c(C)c3c(C)nnc(NCC4CCCN5CCCCC45)c3c2C)c(OC)c1 |
| InChI | InChI=1S/C28H39N5O2/c1-6-35-22-12-13-24(25(16-22)34-5)33-19(3)26-18(2)30-31-28(27(26)20(33)4)29-17-21-10-9-15-32-14-8-7-11-23(21)32/h12-13,16,21,23H,6-11,14-15,17H2,1-5H3,(H,29,31) |
| InChIKey | QAOKGGAOCQVHFO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 64.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |