C24H32N5O+ — CID 58670158
1-[4-[5-(1-cyclopentyl-3-ethyl-2H-indazol-1-ium-6-yl)pyrazol-1-yl]piperidin-1-yl]ethanone (PubChem CID 58670158) has the molecular formula C24H32N5O+ and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[4-[5-(1-cyclopentyl-3-ethyl-2H-indazol-1-ium-6-yl)pyrazol-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[5-(1-cyclopentyl-3-ethyl-2H-indazol-1-ium-6-yl)pyrazol-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 58670158 |
| Molecular Formula | C24H32N5O+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-[4-[5-(1-cyclopentyl-3-ethyl-2H-indazol-1-ium-6-yl)pyrazol-1-yl]piperidin-1-yl]ethanone |
| SMILES | CCc1[nH][n+](C2CCCC2)c2cc(-c3ccnn3C3CCN(C(C)=O)CC3)ccc12 |
| InChI | InChI=1S/C24H31N5O/c1-3-22-21-9-8-18(16-24(21)29(26-22)19-6-4-5-7-19)23-10-13-25-28(23)20-11-14-27(15-12-20)17(2)30/h8-10,13,16,19-20H,3-7,11-12,14-15H2,1-2H3/p+1 |
| InChIKey | UCHCVTQHUZYXPG-UHFFFAOYSA-O |
| XLogP | 4.18 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|