C34H27N5O — CID 58670290
8-isocyano-15-methyl-N-[5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide (PubChem CID 58670290) has the molecular formula C34H27N5O and a molecular weight of 521.62 g/mol. Its IUPAC name is 8-isocyano-15-methyl-N-[5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide.
| Compound Name | 8-isocyano-15-methyl-N-[5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
|---|---|
| PubChem CID | 58670290 |
| Molecular Formula | C34H27N5O |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 8-isocyano-15-methyl-N-[5-[(4-pyridin-4-ylphenyl)methyl]-1H-imidazol-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxamide |
| SMILES | [C-]#[N+]C12CC(C)(C(=O)Nc3ncc(Cc4ccc(-c5ccncc5)cc4)[nH]3)C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C34H27N5O/c1-33(21-34(35-2)28-9-5-3-7-26(28)30(33)27-8-4-6-10-29(27)34)31(40)39-32-37-20-25(38-32)19-22-11-13-23(14-12-22)24-15-17-36-18-16-24/h3-18,20,30H,19,21H2,1H3,(H2,37,38,39,40) |
| InChIKey | ZFFVAJARSOMICS-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|